Products 875305-88-7
CAS 875305-88-7 appears in our catalog under these names: 5,6-Difluoro-1H-indole-7-carboxylic acid, 97%, 5,6-difluoro-1H-indole-7-carboxylic acid, 96%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 100mg, 500mg.
5,6-difluoro-1H-indole-7-carboxylic acid (CAS 875305-88-7) is a chemical compound with the molecular formula C9H5F2NO2 and a molecular weight of 197.14 g/mol. IUPAC name: 5,6-difluoro-1H-indole-7-carboxylic acid. InChIKey: USWILYKEHMIXBB-UHFFFAOYSA-N.
| Molecular formula | C9H5F2NO2 |
|---|---|
| Molecular weight | 197.14 g/mol |
| IUPAC name | 5,6-difluoro-1H-indole-7-carboxylic acid |
| InChIKey | USWILYKEHMIXBB-UHFFFAOYSA-N |
| SMILES | C1=CNC2=C(C(=C(C=C21)F)F)C(=O)O |
Computed by PubChem (NCBI)