CAS 875664-52-1 appears in our catalog under these names: 3,4–Difluoro–2–methoxybenzoic acid, 3,4-Difluoro-2-methoxybenzoic acid, 3,4-Difluoro-2-methoxybenzoic acid 98%, 3,4-Difluoro-2-methoxybenzoic acid, 97%. Offered by: GLPBio, Biosynth, Ambeed, Fluorochem. Available pack sizes: 25g, 5g, 10g, 50g, 100g, 1g, 500g, 250mg.
3,4-difluoro-2-methoxybenzoic acid (CAS 875664-52-1) is a chemical compound with the molecular formula C8H6F2O3 and a molecular weight of 188.13 g/mol. IUPAC name: 3,4-difluoro-2-methoxybenzoic acid. InChIKey: BGBIVLWLYHILBQ-UHFFFAOYSA-N.
| Molecular formula | C8H6F2O3 |
|---|---|
| Molecular weight | 188.13 g/mol |
| IUPAC name | 3,4-difluoro-2-methoxybenzoic acid |
| InChIKey | BGBIVLWLYHILBQ-UHFFFAOYSA-N |
| SMILES | COC1=C(C=CC(=C1F)F)C(=O)O |
Computed by PubChem (NCBI)