CAS 87626-55-9 is the registry number for Mitoflaxone. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-(4-oxo-2-phenylchromen-8-yl)acetic acid (CAS 87626-55-9) is a chemical compound with the molecular formula C17H12O4 and a molecular weight of 280.27 g/mol. IUPAC name: 2-(4-oxo-2-phenylchromen-8-yl)acetic acid. InChIKey: TZZNWMJZDWYJAZ-UHFFFAOYSA-N.
| Molecular formula | C17H12O4 |
|---|---|
| Molecular weight | 280.27 g/mol |
| IUPAC name | 2-(4-oxo-2-phenylchromen-8-yl)acetic acid |
| InChIKey | TZZNWMJZDWYJAZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC(=O)C3=CC=CC(=C3O2)CC(=O)O |
Computed by PubChem (NCBI)