CAS 876372-85-9 is the registry number for 2-(2,4-Difluorophenyl)-N-methoxy-N-methylacetamide, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
2-(2,4-difluorophenyl)-N-methoxy-N-methylacetamide (CAS 876372-85-9) is a chemical compound with the molecular formula C10H11F2NO2 and a molecular weight of 215.20 g/mol. IUPAC name: 2-(2,4-difluorophenyl)-N-methoxy-N-methylacetamide. InChIKey: FHUVLJHMUOWSHE-UHFFFAOYSA-N.
| Molecular formula | C10H11F2NO2 |
|---|---|
| Molecular weight | 215.20 g/mol |
| IUPAC name | 2-(2,4-difluorophenyl)-N-methoxy-N-methylacetamide |
| InChIKey | FHUVLJHMUOWSHE-UHFFFAOYSA-N |
| SMILES | CN(C(=O)CC1=C(C=C(C=C1)F)F)OC |
Computed by PubChem (NCBI)