CAS 87708-46-1 appears in our catalog under these names: Adrenochrome Impurity 2, Adrenolutin. Offered by: Chemat Brand. Available pack sizes: on request.
5,6-dihydroxy-1-methyl-2H-indol-3-one (CAS 87708-46-1) is a chemical compound with the molecular formula C9H9NO3 and a molecular weight of 179.17 g/mol. IUPAC name: 5,6-dihydroxy-1-methyl-2H-indol-3-one. InChIKey: FRBBSLWYVVQVSY-UHFFFAOYSA-N.
| Molecular formula | C9H9NO3 |
|---|---|
| Molecular weight | 179.17 g/mol |
| IUPAC name | 5,6-dihydroxy-1-methyl-2H-indol-3-one |
| InChIKey | FRBBSLWYVVQVSY-UHFFFAOYSA-N |
| SMILES | CN1CC(=O)C2=CC(=C(C=C21)O)O |
Computed by PubChem (NCBI)