Products 87725-60-8
CAS 87725-60-8 is the registry number for Smyrindiol. Offered by: MedChemExpress. Available pack sizes: Get quote.
(2S,3R)-3-hydroxy-2-(2-hydroxypropan-2-yl)-2,3-dihydrofuro[3,2-g]chromen-7-one (CAS 87725-60-8) is a chemical compound with the molecular formula C14H14O5 and a molecular weight of 262.26 g/mol. IUPAC name: (2S,3R)-3-hydroxy-2-(2-hydroxypropan-2-yl)-2,3-dihydrofuro[3,2-g]chromen-7-one. InChIKey: AIQSGHBQRRSBCN-OLZOCXBDSA-N.
| Molecular formula | C14H14O5 |
|---|---|
| Molecular weight | 262.26 g/mol |
| IUPAC name | (2S,3R)-3-hydroxy-2-(2-hydroxypropan-2-yl)-2,3-dihydrofuro[3,2-g]chromen-7-one |
| InChIKey | AIQSGHBQRRSBCN-OLZOCXBDSA-N |
| SMILES | CC(C)([C@@H]1[C@@H](C2=C(O1)C=C3C(=C2)C=CC(=O)O3)O)O |
Computed by PubChem (NCBI)