Products 877674-90-3
CAS 877674-90-3 is the registry number for 6-(Thiophen-3-yl)pyridine-3-carboxylic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
6-thiophen-3-ylpyridine-3-carboxylic acid (CAS 877674-90-3) is a chemical compound with the molecular formula C10H7NO2S and a molecular weight of 205.23 g/mol. IUPAC name: 6-thiophen-3-ylpyridine-3-carboxylic acid. InChIKey: IURKJCFGWINKMI-UHFFFAOYSA-N.
| Molecular formula | C10H7NO2S |
|---|---|
| Molecular weight | 205.23 g/mol |
| IUPAC name | 6-thiophen-3-ylpyridine-3-carboxylic acid |
| InChIKey | IURKJCFGWINKMI-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC=C1C(=O)O)C2=CSC=C2 |
Computed by PubChem (NCBI)
Synonyms:
3-Pyridinecarboxylicacid, 6-(3-thienyl)-, 6-thiophen-3-ylpyridine-3-carboxylic acid, 6-(thiophen-3-yl)-nicotinic acid, 6-(Thiophen-3-yl)pyridine-3-carboxylic acid, 6-(3-Thienyl)-3-pyridinecarboxylic acid, 6-(Thiophen-3-yl)nicotinicacid, 6-thiophen-3-yl-nicotinic acid, IURKJCFGWINKMI-UHFFFAOYSA-N, 6-(3-thienyl)pyridine-3-carboxylic acid