CAS 877758-98-0 appears in our catalog under these names: 4-(Thiazol-4-yl)benzoic acid, 95+%, 4-(1,3-Thiazol-4-yl)benzoic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
4-(1,3-thiazol-4-yl)benzoic acid (CAS 877758-98-0) is a chemical compound with the molecular formula C10H7NO2S and a molecular weight of 205.23 g/mol. IUPAC name: 4-(1,3-thiazol-4-yl)benzoic acid. InChIKey: DJJLKDMESZPSAM-UHFFFAOYSA-N.
| Molecular formula | C10H7NO2S |
|---|---|
| Molecular weight | 205.23 g/mol |
| IUPAC name | 4-(1,3-thiazol-4-yl)benzoic acid |
| InChIKey | DJJLKDMESZPSAM-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CSC=N2)C(=O)O |
Computed by PubChem (NCBI)