CAS 877825-72-4 appears in our catalog under these names: 6-Amino-7-fluoroquinazolin-4-ol, 98%, 6-Amino-7-fluoro-3,4-dihydroquinazolin-4-one. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 10g, 1g, 250mg, 2,5g.
6-amino-7-fluoro-3H-quinazolin-4-one (CAS 877825-72-4) is a chemical compound with the molecular formula C8H6FN3O and a molecular weight of 179.15 g/mol. IUPAC name: 6-amino-7-fluoro-3H-quinazolin-4-one. InChIKey: QWHMKSRMYPVROB-UHFFFAOYSA-N.
| Molecular formula | C8H6FN3O |
|---|---|
| Molecular weight | 179.15 g/mol |
| IUPAC name | 6-amino-7-fluoro-3H-quinazolin-4-one |
| InChIKey | QWHMKSRMYPVROB-UHFFFAOYSA-N |
| SMILES | C1=C2C(=CC(=C1N)F)N=CNC2=O |
Computed by PubChem (NCBI)