CAS 87894-65-3 is the registry number for 3-Acetoxy-3-methylpentane-1,5-dioic Acid Anhydride. Offered by: TRC. Available pack sizes: 1g, 2,5g, 500mg.
(4-methyl-2,6-dioxooxan-4-yl) acetate (CAS 87894-65-3) is a chemical compound with the molecular formula C8H10O5 and a molecular weight of 186.16 g/mol. IUPAC name: (4-methyl-2,6-dioxooxan-4-yl) acetate. InChIKey: DJIZBLQWKZGCHU-UHFFFAOYSA-N.
| Molecular formula | C8H10O5 |
|---|---|
| Molecular weight | 186.16 g/mol |
| IUPAC name | (4-methyl-2,6-dioxooxan-4-yl) acetate |
| InChIKey | DJIZBLQWKZGCHU-UHFFFAOYSA-N |
| SMILES | CC(=O)OC1(CC(=O)OC(=O)C1)C |
Computed by PubChem (NCBI)