Products 87896-53-5
CAS 87896-53-5 is the registry number for A-58365B. Offered by: MedChemExpress. Available pack sizes: Get quote.
7-(2-carboxyethyl)-9-hydroxy-6-oxo-1,2,3,4-tetrahydroquinolizine-4-carboxylic acid (CAS 87896-53-5) is a chemical compound with the molecular formula C13H15NO6 and a molecular weight of 281.26 g/mol. IUPAC name: 7-(2-carboxyethyl)-9-hydroxy-6-oxo-1,2,3,4-tetrahydroquinolizine-4-carboxylic acid. InChIKey: UJJUUOQJYAUBKD-UHFFFAOYSA-N.
| Molecular formula | C13H15NO6 |
|---|---|
| Molecular weight | 281.26 g/mol |
| IUPAC name | 7-(2-carboxyethyl)-9-hydroxy-6-oxo-1,2,3,4-tetrahydroquinolizine-4-carboxylic acid |
| InChIKey | UJJUUOQJYAUBKD-UHFFFAOYSA-N |
| SMILES | C1CC(N2C(=C(C=C(C2=O)CCC(=O)O)O)C1)C(=O)O |
Computed by PubChem (NCBI)