CAS 881-26-5 is the registry number for (S)-Salsoline Hydrochloride. Offered by: TRC. Available pack sizes: 0,5mg, 2,5mg, 5mg.
(1S)-7-methoxy-1-methyl-1,2,3,4-tetrahydroisoquinolin-6-ol;hydrochloride (CAS 881-26-5) is a chemical compound with the molecular formula C11H16ClNO2 and a molecular weight of 229.70 g/mol. IUPAC name: (1S)-7-methoxy-1-methyl-1,2,3,4-tetrahydroisoquinolin-6-ol;hydrochloride. InChIKey: PZZVNEZKNWRZEG-FJXQXJEOSA-N.
| Molecular formula | C11H16ClNO2 |
|---|---|
| Molecular weight | 229.70 g/mol |
| IUPAC name | (1S)-7-methoxy-1-methyl-1,2,3,4-tetrahydroisoquinolin-6-ol;hydrochloride |
| InChIKey | PZZVNEZKNWRZEG-FJXQXJEOSA-N |
| SMILES | C[C@H]1C2=CC(=C(C=C2CCN1)O)OC.Cl |
Computed by PubChem (NCBI)