CAS 881921-10-4 appears in our catalog under these names: N-[(9H-Fluoren-9-ylmethoxy)carbonyl]-2-methyl-L-norvaline, 98%, 98%, (S)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-2-methylpentanoic acid, 98%, Fmoc-α-Me-L-Nva-OH, 98%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 10g, 100mg, 250mg, 1g, 5g.
(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-2-methylpentanoic acid (CAS 881921-10-4) is a chemical compound with the molecular formula C21H23NO4 and a molecular weight of 353.4 g/mol. IUPAC name: (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-2-methylpentanoic acid. InChIKey: JJDVDOMASOCGOV-NRFANRHFSA-N.
| Molecular formula | C21H23NO4 |
|---|---|
| Molecular weight | 353.4 g/mol |
| IUPAC name | (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-2-methylpentanoic acid |
| InChIKey | JJDVDOMASOCGOV-NRFANRHFSA-N |
| SMILES | CCC[C@@](C)(C(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
Computed by PubChem (NCBI)