CAS 882238-14-4 appears in our catalog under these names: 5–(2,5–Dimethoxyphenyl)–1H–pyrazole–3–carboxylic acid, 5-(2,5-Dimethoxyphenyl)-1H-pyrazole-3-carboxylic acid, 95%. Offered by: GLPBio, Ambeed. Available pack sizes: 1g, 250mg, 5g.
3-(2,5-dimethoxyphenyl)-1H-pyrazole-5-carboxylic acid (CAS 882238-14-4) is a chemical compound with the molecular formula C12H12N2O4 and a molecular weight of 248.23 g/mol. IUPAC name: 3-(2,5-dimethoxyphenyl)-1H-pyrazole-5-carboxylic acid. InChIKey: WURQRAFRDPPKJG-UHFFFAOYSA-N.
| Molecular formula | C12H12N2O4 |
|---|---|
| Molecular weight | 248.23 g/mol |
| IUPAC name | 3-(2,5-dimethoxyphenyl)-1H-pyrazole-5-carboxylic acid |
| InChIKey | WURQRAFRDPPKJG-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1)OC)C2=NNC(=C2)C(=O)O |
Computed by PubChem (NCBI)