CAS 882679-16-5 appears in our catalog under these names: 7-Bromo-6-methyl-2,3-dihydro-1h-indole-2,3-dione, 95%, 7-Bromo-6-methyl-2,3-dihydro-1H-indole-2,3-dione, 7-Bromo-6-methylindoline-2,3-dione, 95%, 95%, 7-Bromo-6-methylindoline-2,3-dione, 97%. Offered by: Combi-blocks, Biosynth, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg.
7-bromo-6-methyl-1H-indole-2,3-dione (CAS 882679-16-5) is a chemical compound with the molecular formula C9H6BrNO2 and a molecular weight of 240.05 g/mol. IUPAC name: 7-bromo-6-methyl-1H-indole-2,3-dione. InChIKey: DHJTTXFAQSTPSK-UHFFFAOYSA-N.
| Molecular formula | C9H6BrNO2 |
|---|---|
| Molecular weight | 240.05 g/mol |
| IUPAC name | 7-bromo-6-methyl-1H-indole-2,3-dione |
| InChIKey | DHJTTXFAQSTPSK-UHFFFAOYSA-N |
| SMILES | CC1=C(C2=C(C=C1)C(=O)C(=O)N2)Br |
Computed by PubChem (NCBI)