CAS 883-21-6 appears in our catalog under these names: 1-Methoxy-2-naphthoic acid, 95%, 1-Methoxy-2-naphthoic acid 95%, 1-Methoxy-2-naphthalenecarboxylic acid, 95%, 95%, 1-methoxy-2-naphthoic acid, 98%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 10g, 1g, 25g, 5g, 250mg, 100g.
1-methoxynaphthalene-2-carboxylic acid (CAS 883-21-6) is a chemical compound with the molecular formula C12H10O3 and a molecular weight of 202.21 g/mol. IUPAC name: 1-methoxynaphthalene-2-carboxylic acid. InChIKey: PMJACRPIWSINFF-UHFFFAOYSA-N.
| Molecular formula | C12H10O3 |
|---|---|
| Molecular weight | 202.21 g/mol |
| IUPAC name | 1-methoxynaphthalene-2-carboxylic acid |
| InChIKey | PMJACRPIWSINFF-UHFFFAOYSA-N |
| SMILES | COC1=C(C=CC2=CC=CC=C21)C(=O)O |
Computed by PubChem (NCBI)