CAS 883535-98-6 is the registry number for 2,5-Difluoro-4-ethoxybenzaldehyde, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 1g, 250mg.
4-ethoxy-2,5-difluorobenzaldehyde (CAS 883535-98-6) is a chemical compound with the molecular formula C9H8F2O2 and a molecular weight of 186.15 g/mol. IUPAC name: 4-ethoxy-2,5-difluorobenzaldehyde. InChIKey: CYQANVOIVQRLCI-UHFFFAOYSA-N.
| Molecular formula | C9H8F2O2 |
|---|---|
| Molecular weight | 186.15 g/mol |
| IUPAC name | 4-ethoxy-2,5-difluorobenzaldehyde |
| InChIKey | CYQANVOIVQRLCI-UHFFFAOYSA-N |
| SMILES | CCOC1=C(C=C(C(=C1)F)C=O)F |
Computed by PubChem (NCBI)