CAS 88376-09-4 is the registry number for (S)-2-Amino-2,4-dimethylpentanoic acid hydrochloride, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
(2S)-2-amino-2,4-dimethylpentanoic acid;hydrochloride (CAS 88376-09-4) is a chemical compound with the molecular formula C7H16ClNO2 and a molecular weight of 181.66 g/mol. IUPAC name: (2S)-2-amino-2,4-dimethylpentanoic acid;hydrochloride. InChIKey: ZESCTDHOWCQMPQ-FJXQXJEOSA-N.
| Molecular formula | C7H16ClNO2 |
|---|---|
| Molecular weight | 181.66 g/mol |
| IUPAC name | (2S)-2-amino-2,4-dimethylpentanoic acid;hydrochloride |
| InChIKey | ZESCTDHOWCQMPQ-FJXQXJEOSA-N |
| SMILES | CC(C)C[C@@](C)(C(=O)O)N.Cl |
Computed by PubChem (NCBI)