Products 88376-09-4

CAS 88376-09-4 is the registry number for (S)-2-Amino-2,4-dimethylpentanoic acid hydrochloride, 95%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

(2S)-2-amino-2,4-dimethylpentanoic acid;hydrochloride (CAS 88376-09-4) is a chemical compound with the molecular formula C7H16ClNO2 and a molecular weight of 181.66 g/mol. IUPAC name: (2S)-2-amino-2,4-dimethylpentanoic acid;hydrochloride. InChIKey: ZESCTDHOWCQMPQ-FJXQXJEOSA-N.

Identity
Molecular formulaC7H16ClNO2
Molecular weight181.66 g/mol
IUPAC name(2S)-2-amino-2,4-dimethylpentanoic acid;hydrochloride
InChIKeyZESCTDHOWCQMPQ-FJXQXJEOSA-N
SMILESCC(C)C[C@@](C)(C(=O)O)N.Cl

Computed by PubChem (NCBI)