CAS 884855-67-8 appears in our catalog under these names: 4-Bromo-1-methylindoline-2,3-dione, 95%, 4-Bromo-1-methylindoline-2,3-dione, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 25g, 10g, 5g, 250mg.
4-bromo-1-methylindole-2,3-dione (CAS 884855-67-8) is a chemical compound with the molecular formula C9H6BrNO2 and a molecular weight of 240.05 g/mol. IUPAC name: 4-bromo-1-methylindole-2,3-dione. InChIKey: YIXIWKWPNPKAKX-UHFFFAOYSA-N.
| Molecular formula | C9H6BrNO2 |
|---|---|
| Molecular weight | 240.05 g/mol |
| IUPAC name | 4-bromo-1-methylindole-2,3-dione |
| InChIKey | YIXIWKWPNPKAKX-UHFFFAOYSA-N |
| SMILES | CN1C2=C(C(=CC=C2)Br)C(=O)C1=O |
Computed by PubChem (NCBI)