CAS 885518-90-1 appears in our catalog under these names: 4-Methyl-1H-indazole-3-carboxylic acid 97%, 4-Methyl-1H-indazole-3-carboxylic acid, 97%, 97%, 4-METHYL-1H-INDAZOLE-3-CARBOXYLIC ACID, 97%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 500mg.
4-methyl-1H-indazole-3-carboxylic acid (CAS 885518-90-1) is a chemical compound with the molecular formula C9H8N2O2 and a molecular weight of 176.17 g/mol. IUPAC name: 4-methyl-1H-indazole-3-carboxylic acid. InChIKey: PNRZINGBFITCFA-UHFFFAOYSA-N.
| Molecular formula | C9H8N2O2 |
|---|---|
| Molecular weight | 176.17 g/mol |
| IUPAC name | 4-methyl-1H-indazole-3-carboxylic acid |
| InChIKey | PNRZINGBFITCFA-UHFFFAOYSA-N |
| SMILES | CC1=C2C(=CC=C1)NN=C2C(=O)O |
Computed by PubChem (NCBI)