CAS 885520-31-0 appears in our catalog under these names: 4–Fluoro–1H–indole–6–carboxylic acid, 4-Fluoro-1H-indole-6-carboxylic acid, 4-Fluoro-1H-indole-6-carboxylic acid, 95%, 95%, 4-Fluoro-1H-indole-6-carboxylic acid, 97%. Offered by: GLPBio, Biosynth, Chemat, Fluorochem. Available pack sizes: 100mg, 1g, 250mg, 5g, 0,5g.
4-fluoro-1H-indole-6-carboxylic acid (CAS 885520-31-0) is a chemical compound with the molecular formula C9H6FNO2 and a molecular weight of 179.15 g/mol. IUPAC name: 4-fluoro-1H-indole-6-carboxylic acid. InChIKey: AZRLJGFDKLHDFM-UHFFFAOYSA-N.
| Molecular formula | C9H6FNO2 |
|---|---|
| Molecular weight | 179.15 g/mol |
| IUPAC name | 4-fluoro-1H-indole-6-carboxylic acid |
| InChIKey | AZRLJGFDKLHDFM-UHFFFAOYSA-N |
| SMILES | C1=CNC2=C1C(=CC(=C2)C(=O)O)F |
Computed by PubChem (NCBI)