CAS 885520-65-0 is the registry number for 4-Bromo-6-fluoro-1H-indazole-3-carboxylic acid, 95%, 95%. Offered by: Chemat. Available pack sizes: 25mg, 50mg, 100mg, 250mg.
4-bromo-6-fluoro-1H-indazole-3-carboxylic acid (CAS 885520-65-0) is a chemical compound with the molecular formula C8H4BrFN2O2 and a molecular weight of 259.03 g/mol. IUPAC name: 4-bromo-6-fluoro-1H-indazole-3-carboxylic acid. InChIKey: KLAHIEDAPOFRDG-UHFFFAOYSA-N.
| Molecular formula | C8H4BrFN2O2 |
|---|---|
| Molecular weight | 259.03 g/mol |
| IUPAC name | 4-bromo-6-fluoro-1H-indazole-3-carboxylic acid |
| InChIKey | KLAHIEDAPOFRDG-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C2=C1NN=C2C(=O)O)Br)F |
Computed by PubChem (NCBI)