CAS 886370-26-9 appears in our catalog under these names: 2-(2,4-Dimethylphenyl)-1,3-thiazole-5-carboxylic acid, 95%, 2-(2,4-Dimethylphenyl)thiazole-5-carboxylic acid, 98%, 2-(2,4-Dimethylphenyl)-1,3-thiazole-5-carboxylic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
2-(2,4-dimethylphenyl)-1,3-thiazole-5-carboxylic acid (CAS 886370-26-9) is a chemical compound with the molecular formula C12H11NO2S and a molecular weight of 233.29 g/mol. IUPAC name: 2-(2,4-dimethylphenyl)-1,3-thiazole-5-carboxylic acid. InChIKey: VQAQHESOPWLQDG-UHFFFAOYSA-N.
| Molecular formula | C12H11NO2S |
|---|---|
| Molecular weight | 233.29 g/mol |
| IUPAC name | 2-(2,4-dimethylphenyl)-1,3-thiazole-5-carboxylic acid |
| InChIKey | VQAQHESOPWLQDG-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)C2=NC=C(S2)C(=O)O)C |
Computed by PubChem (NCBI)