CAS 886494-83-3 appears in our catalog under these names: 4-(1,3-Dioxaindan-5-yl)-2-hydrazinyl-1,3-thiazole, (4-Benzo[1,3]dioxol-5-yl-thiazol-2-yl)-hydrazine. Offered by: Biosynth, Fluorochem. Available pack sizes: 0,5g, 50mg, 1g.
[4-(1,3-benzodioxol-5-yl)-1,3-thiazol-2-yl]hydrazine (CAS 886494-83-3) is a chemical compound with the molecular formula C10H9N3O2S and a molecular weight of 235.26 g/mol. IUPAC name: [4-(1,3-benzodioxol-5-yl)-1,3-thiazol-2-yl]hydrazine. InChIKey: QASFMCYWDUIKQB-UHFFFAOYSA-N.
| Molecular formula | C10H9N3O2S |
|---|---|
| Molecular weight | 235.26 g/mol |
| IUPAC name | [4-(1,3-benzodioxol-5-yl)-1,3-thiazol-2-yl]hydrazine |
| InChIKey | QASFMCYWDUIKQB-UHFFFAOYSA-N |
| SMILES | C1OC2=C(O1)C=C(C=C2)C3=CSC(=N3)NN |
Computed by PubChem (NCBI)