CAS 886498-84-6 appears in our catalog under these names: 2',6'-Difluoro-4'-methoxyacetophenone, 98%, 2',6'-Difluoro-4'-methoxyacetophenone, 97%, 97%, 1-(2,6-Difluoro-4-methoxyphenyl)ethanone, 97%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 10g, 25g, 100mg, 250mg.
1-(2,6-difluoro-4-methoxyphenyl)ethanone (CAS 886498-84-6) is a chemical compound with the molecular formula C9H8F2O2 and a molecular weight of 186.15 g/mol. IUPAC name: 1-(2,6-difluoro-4-methoxyphenyl)ethanone. InChIKey: YZVNPIUPAKOREH-UHFFFAOYSA-N.
| Molecular formula | C9H8F2O2 |
|---|---|
| Molecular weight | 186.15 g/mol |
| IUPAC name | 1-(2,6-difluoro-4-methoxyphenyl)ethanone |
| InChIKey | YZVNPIUPAKOREH-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=C(C=C(C=C1F)OC)F |
Computed by PubChem (NCBI)