Products 886755-63-1
CAS 886755-63-1 is the registry number for CHS-111. Offered by: MedChemExpress. Available pack sizes: Get quote.
[4-(2-benzylindazol-3-yl)phenyl]methanol (CAS 886755-63-1) is a chemical compound with the molecular formula C21H18N2O and a molecular weight of 314.4 g/mol. IUPAC name: [4-(2-benzylindazol-3-yl)phenyl]methanol. InChIKey: GUQSBGZNHKRJGO-UHFFFAOYSA-N.
| Molecular formula | C21H18N2O |
|---|---|
| Molecular weight | 314.4 g/mol |
| IUPAC name | [4-(2-benzylindazol-3-yl)phenyl]methanol |
| InChIKey | GUQSBGZNHKRJGO-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CN2C(=C3C=CC=CC3=N2)C4=CC=C(C=C4)CO |
Computed by PubChem (NCBI)