CAS 887585-05-9 appears in our catalog under these names: (6–Amino–2,3–difluorophenyl)acetic acid, (6-Amino-2,3-difluorophenyl)acetic acid 95%, (6-Amino-2,3-difluorophenyl)acetic acid, 95%, 95%, (6-AMINO-2,3-DIFLUOROPHENYL)ACETIC ACID, 95%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g.
2-(6-amino-2,3-difluorophenyl)acetic acid (CAS 887585-05-9) is a chemical compound with the molecular formula C8H7F2NO2 and a molecular weight of 187.14 g/mol. IUPAC name: 2-(6-amino-2,3-difluorophenyl)acetic acid. InChIKey: NOFDHMCJUZZSIV-UHFFFAOYSA-N.
| Molecular formula | C8H7F2NO2 |
|---|---|
| Molecular weight | 187.14 g/mol |
| IUPAC name | 2-(6-amino-2,3-difluorophenyl)acetic acid |
| InChIKey | NOFDHMCJUZZSIV-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1N)CC(=O)O)F)F |
Computed by PubChem (NCBI)