CAS 887973-34-4 appears in our catalog under these names: 5-(3-Methylphenyl)nicotinic acid, 97%, 5-(3-Methylphenyl)nicotinic acid, 5-(3-Methylphenyl)-3-pyridinecarboxylic acid, 97%, 97%. Offered by: Combi-blocks, Biosynth, Chemat. Available pack sizes: 10g, 5g, 1g, 100mg, 250mg.
5-(3-methylphenyl)pyridine-3-carboxylic acid (CAS 887973-34-4) is a chemical compound with the molecular formula C13H11NO2 and a molecular weight of 213.23 g/mol. IUPAC name: 5-(3-methylphenyl)pyridine-3-carboxylic acid. InChIKey: KQXMMUCUYGOXEX-UHFFFAOYSA-N.
| Molecular formula | C13H11NO2 |
|---|---|
| Molecular weight | 213.23 g/mol |
| IUPAC name | 5-(3-methylphenyl)pyridine-3-carboxylic acid |
| InChIKey | KQXMMUCUYGOXEX-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC=C1)C2=CC(=CN=C2)C(=O)O |
Computed by PubChem (NCBI)