CAS 89-24-7 appears in our catalog under these names: 5-Phenylhydantoin, 95%, 5-Phenylhydantoin, 5–Phenylhydantoin, Phenylhydantoin, 5-Phenylhydantoin, >99.0%(HPLC)(T). Offered by: Combi-blocks, TRC, GLPBio, TargetMol, TCI. Available pack sizes: 25g, 1g, 5g, 250mg, 500mg, 50mg, 100mg, 200mg.
5-phenylimidazolidine-2,4-dione (CAS 89-24-7) is a chemical compound with the molecular formula C9H8N2O2 and a molecular weight of 176.17 g/mol. IUPAC name: 5-phenylimidazolidine-2,4-dione. InChIKey: NXQJDVBMMRCKQG-UHFFFAOYSA-N.
| Molecular formula | C9H8N2O2 |
|---|---|
| Molecular weight | 176.17 g/mol |
| IUPAC name | 5-phenylimidazolidine-2,4-dione |
| InChIKey | NXQJDVBMMRCKQG-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2C(=O)NC(=O)N2 |
Computed by PubChem (NCBI)