Products 890984-26-6
CAS 890984-26-6 appears in our catalog under these names: Curcumin 5–8, Curcumin 5-8, 98.58%, Curcumin 5-8, 98%, N-(3-(3-(4-Hydroxy-3-methoxyphenyl)acryloyl)phenyl)isobutyramide, 98%. Offered by: GLPBio, MedChemExpress, Ambeed, BLDpharm. Available pack sizes: 10mg, 25mg, 5mg, 10mM (in 1ml dmso), 50mg, 10mM/1mL, 100 mg, 5 mg.
N-[3-[(E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoyl]phenyl]-2-methylpropanamide (CAS 890984-26-6) is a chemical compound with the molecular formula C20H21NO4 and a molecular weight of 339.4 g/mol. IUPAC name: N-[3-[(E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoyl]phenyl]-2-methylpropanamide. InChIKey: KKIKIJNZVGWYGI-VQHVLOKHSA-N.
| Molecular formula | C20H21NO4 |
|---|---|
| Molecular weight | 339.4 g/mol |
| IUPAC name | N-[3-[(E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoyl]phenyl]-2-methylpropanamide |
| InChIKey | KKIKIJNZVGWYGI-VQHVLOKHSA-N |
| SMILES | CC(C)C(=O)NC1=CC=CC(=C1)C(=O)/C=C/C2=CC(=C(C=C2)O)OC |
Computed by PubChem (NCBI)