CAS 89331-01-1 is the registry number for 3,4-Dihydro-5-nitro-2(1H)-naphthalenone. Offered by: TRC. Available pack sizes: 100mg.
5-nitro-3,4-dihydro-1H-naphthalen-2-one (CAS 89331-01-1) is a chemical compound with the molecular formula C10H9NO3 and a molecular weight of 191.18 g/mol. IUPAC name: 5-nitro-3,4-dihydro-1H-naphthalen-2-one. InChIKey: HCTMHJVZTNLVLJ-UHFFFAOYSA-N.
| Molecular formula | C10H9NO3 |
|---|---|
| Molecular weight | 191.18 g/mol |
| IUPAC name | 5-nitro-3,4-dihydro-1H-naphthalen-2-one |
| InChIKey | HCTMHJVZTNLVLJ-UHFFFAOYSA-N |
| SMILES | C1CC2=C(CC1=O)C=CC=C2[N+](=O)[O-] |
Computed by PubChem (NCBI)