CAS 893723-81-4 appears in our catalog under these names: 6-(Thiophen-3-yl)picolinic acid, 96%, 6-(Thiophen-3-yl)picolinic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 10g, 1g, 250mg, 0,5g, 50mg.
6-thiophen-3-ylpyridine-2-carboxylic acid (CAS 893723-81-4) is a chemical compound with the molecular formula C10H7NO2S and a molecular weight of 205.23 g/mol. IUPAC name: 6-thiophen-3-ylpyridine-2-carboxylic acid. InChIKey: OWCIGXCPSXNXGD-UHFFFAOYSA-N.
| Molecular formula | C10H7NO2S |
|---|---|
| Molecular weight | 205.23 g/mol |
| IUPAC name | 6-thiophen-3-ylpyridine-2-carboxylic acid |
| InChIKey | OWCIGXCPSXNXGD-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC(=C1)C(=O)O)C2=CSC=C2 |
Computed by PubChem (NCBI)