CAS 893737-23-0 appears in our catalog under these names: 5-p-Tolylnicotinic acid, 98%, 5-p-Tolylnicotinic acid. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 10g, 5g, 2,5g.
5-(4-methylphenyl)pyridine-3-carboxylic acid (CAS 893737-23-0) is a chemical compound with the molecular formula C13H11NO2 and a molecular weight of 213.23 g/mol. IUPAC name: 5-(4-methylphenyl)pyridine-3-carboxylic acid. InChIKey: VMJRUHLJFKPQHV-UHFFFAOYSA-N.
| Molecular formula | C13H11NO2 |
|---|---|
| Molecular weight | 213.23 g/mol |
| IUPAC name | 5-(4-methylphenyl)pyridine-3-carboxylic acid |
| InChIKey | VMJRUHLJFKPQHV-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C2=CC(=CN=C2)C(=O)O |
Computed by PubChem (NCBI)