CAS 89433-16-9 appears in our catalog under these names: 6-Methoxy-2,4-dihydro-1h-3,1-benzoxazin-2-one, 95%, 6-Methoxy-2,4-dihydro-1H-3,1-benzoxazin-2-one. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 5g, 0,5g, 50mg.
6-methoxy-1,4-dihydro-3,1-benzoxazin-2-one (CAS 89433-16-9) is a chemical compound with the molecular formula C9H9NO3 and a molecular weight of 179.17 g/mol. IUPAC name: 6-methoxy-1,4-dihydro-3,1-benzoxazin-2-one. InChIKey: NVJBKLWHTQFMEZ-UHFFFAOYSA-N.
| Molecular formula | C9H9NO3 |
|---|---|
| Molecular weight | 179.17 g/mol |
| IUPAC name | 6-methoxy-1,4-dihydro-3,1-benzoxazin-2-one |
| InChIKey | NVJBKLWHTQFMEZ-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C=C1)NC(=O)OC2 |
Computed by PubChem (NCBI)