Products 89648-76-0
CAS 89648-76-0 is the registry number for FCE 20700. Offered by: MedChemExpress. Available pack sizes: Get quote.
Methyl (Z)-7-[(1R,2S)-2-[(3S,4S)-3-hydroxy-4-methyloct-1-ynyl]-5-oxocyclopentyl]hept-5-enoate (CAS 89648-76-0) is a chemical compound with the molecular formula C22H34O4 and a molecular weight of 362.5 g/mol. IUPAC name: methyl (Z)-7-[(1R,2S)-2-[(3S,4S)-3-hydroxy-4-methyloct-1-ynyl]-5-oxocyclopentyl]hept-5-enoate. InChIKey: WPNSDQNZGLPFNT-LKTBELLOSA-N.
| Molecular formula | C22H34O4 |
|---|---|
| Molecular weight | 362.5 g/mol |
| IUPAC name | methyl (Z)-7-[(1R,2S)-2-[(3S,4S)-3-hydroxy-4-methyloct-1-ynyl]-5-oxocyclopentyl]hept-5-enoate |
| InChIKey | WPNSDQNZGLPFNT-LKTBELLOSA-N |
| SMILES | CCCC[C@H](C)[C@@H](C#C[C@H]1CCC(=O)[C@@H]1C/C=C\CCCC(=O)OC)O |
Computed by PubChem (NCBI)