Products 898790-09-5
CAS 898790-09-5 is the registry number for Methanone, (3-chloro-4-fluorophenyl)cyclopropyl-, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
(3-chloro-4-fluorophenyl)-cyclopropylmethanone (CAS 898790-09-5) is a chemical compound with the molecular formula C10H8ClFO and a molecular weight of 198.62 g/mol. IUPAC name: (3-chloro-4-fluorophenyl)-cyclopropylmethanone. InChIKey: UWLYSHCUFNFEPS-UHFFFAOYSA-N.
| Molecular formula | C10H8ClFO |
|---|---|
| Molecular weight | 198.62 g/mol |
| IUPAC name | (3-chloro-4-fluorophenyl)-cyclopropylmethanone |
| InChIKey | UWLYSHCUFNFEPS-UHFFFAOYSA-N |
| SMILES | C1CC1C(=O)C2=CC(=C(C=C2)F)Cl |
Computed by PubChem (NCBI)