CAS 90111-58-3 appears in our catalog under these names: 4-Carboxymethylphenylboronic acid, 4–Carboxy methylphenylboronic acid(contains varying amounts of Anhydride), 4-(Carboxymethyl)phenylboronic acid, 2-(4-Boronophenyl)acetic acid, 98%, 98%, 2-(4-Boronophenyl)acetic acid, 99.79%. Offered by: TRC, GLPBio, Biosynth, Chemat, MedChemExpress. Available pack sizes: 50mg, 1g, 5g, 50g, 100mg, 250mg, 25g, 10 g.
2-(4-boronophenyl)acetic acid (CAS 90111-58-3) is a chemical compound with the molecular formula C8H9BO4 and a molecular weight of 179.97 g/mol. IUPAC name: 2-(4-boronophenyl)acetic acid. InChIKey: NFGJQVPDPIGBJE-UHFFFAOYSA-N.
| Molecular formula | C8H9BO4 |
|---|---|
| Molecular weight | 179.97 g/mol |
| IUPAC name | 2-(4-boronophenyl)acetic acid |
| InChIKey | NFGJQVPDPIGBJE-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)CC(=O)O)(O)O |
Computed by PubChem (NCBI)