Products 901187-90-4
CAS 901187-90-4 appears in our catalog under these names: N-(2,4-Difluorophenyl)glycine, 95%, 2-((2,4-Difluorophenyl)amino)acetic acid, 97%. Offered by: Combi-blocks, Ambeed, BLDpharm. Available pack sizes: 1g, 5g, 250mg, 100mg.
2-(2,4-difluoroanilino)acetic acid (CAS 901187-90-4) is a chemical compound with the molecular formula C8H7F2NO2 and a molecular weight of 187.14 g/mol. IUPAC name: 2-(2,4-difluoroanilino)acetic acid. InChIKey: STWYUDQLBORQDI-UHFFFAOYSA-N.
| Molecular formula | C8H7F2NO2 |
|---|---|
| Molecular weight | 187.14 g/mol |
| IUPAC name | 2-(2,4-difluoroanilino)acetic acid |
| InChIKey | STWYUDQLBORQDI-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1F)F)NCC(=O)O |
Computed by PubChem (NCBI)