Products 90267-85-9
CAS 90267-85-9 appears in our catalog under these names: 7–(2，5–Dioxo–2，5–dihydro–1H–pyrrol–1–yl)heptanoic acid, 7-(2,5-Dioxo-2,5-dihydro-1H-pyrrol-1-yl)heptanoic acid, 7-(2,5-Dioxo-2,5-dihydro-1H-pyrrol-1-yl)heptanoic acid, 95%, 95%, 7-(2,5-Dioxo-2,5-dihydro-1H-pyrrol-1-yl)heptanoic acid, 98%, 7-(2,5-Dioxo-2,5-dihydro-1H-pyrrol-1-yl)heptanoic acid, 95%. Offered by: GLPBio, Biosynth, Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 5g, 0,5g, 250mg, 1g.
7-(2,5-dioxopyrrol-1-yl)heptanoic acid (CAS 90267-85-9) is a chemical compound with the molecular formula C11H15NO4 and a molecular weight of 225.24 g/mol. IUPAC name: 7-(2,5-dioxopyrrol-1-yl)heptanoic acid. InChIKey: DHELHOUTNAEDJP-UHFFFAOYSA-N.
| Molecular formula | C11H15NO4 |
|---|---|
| Molecular weight | 225.24 g/mol |
| IUPAC name | 7-(2,5-dioxopyrrol-1-yl)heptanoic acid |
| InChIKey | DHELHOUTNAEDJP-UHFFFAOYSA-N |
| SMILES | C1=CC(=O)N(C1=O)CCCCCCC(=O)O |
Computed by PubChem (NCBI)