CAS 902742-33-0 appears in our catalog under these names: 3-Cyclopentylisoxazole-5-carboxylic acid, 95%, 3-Cyclopentyl-1,2-oxazole-5-carboxylic acid, 3-Cyclopentyl-1,2-oxazole-5-carboxylic acid, 95%, 95%, 3-Cyclopentyl-1,2-oxazole-5-carboxylic acid, 95%. Offered by: AmBeed, Biosynth, Chemat, Fluorochem. Available pack sizes: 5g, 250mg, 50mg, 0,5g, 100mg, 1g, 500mg, 2.5g.
3-cyclopentyl-1,2-oxazole-5-carboxylic acid (CAS 902742-33-0) is a chemical compound with the molecular formula C9H11NO3 and a molecular weight of 181.19 g/mol. IUPAC name: 3-cyclopentyl-1,2-oxazole-5-carboxylic acid. InChIKey: BARRKOGFPADROJ-UHFFFAOYSA-N.
| Molecular formula | C9H11NO3 |
|---|---|
| Molecular weight | 181.19 g/mol |
| IUPAC name | 3-cyclopentyl-1,2-oxazole-5-carboxylic acid |
| InChIKey | BARRKOGFPADROJ-UHFFFAOYSA-N |
| SMILES | C1CCC(C1)C2=NOC(=C2)C(=O)O |
Computed by PubChem (NCBI)