CAS 90309-26-5 is the registry number for 4-((3-Chlorophenyl)sulfonyl)benzenamine. Offered by: TRC, Biosynth. Available pack sizes: 100mg, 50mg.
4-(3-chlorophenyl)sulfonylaniline (CAS 90309-26-5) is a chemical compound with the molecular formula C12H10ClNO2S and a molecular weight of 267.73 g/mol. IUPAC name: 4-(3-chlorophenyl)sulfonylaniline. InChIKey: PJJISDXBMJSJLZ-UHFFFAOYSA-N.
| Molecular formula | C12H10ClNO2S |
|---|---|
| Molecular weight | 267.73 g/mol |
| IUPAC name | 4-(3-chlorophenyl)sulfonylaniline |
| InChIKey | PJJISDXBMJSJLZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Cl)S(=O)(=O)C2=CC=C(C=C2)N |
Computed by PubChem (NCBI)