CAS 90322-49-9 appears in our catalog under these names: 8-Nitro-4-chromanone, 95%, 8-Nitro-4-chromanone, 97%, 97%, 8-NITRO-4-CHROMANONE, 97%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 250mg, 10g.
8-nitro-2,3-dihydrochromen-4-one (CAS 90322-49-9) is a chemical compound with the molecular formula C9H7NO4 and a molecular weight of 193.16 g/mol. IUPAC name: 8-nitro-2,3-dihydrochromen-4-one. InChIKey: MXMKEUBEHSMVOG-UHFFFAOYSA-N.
| Molecular formula | C9H7NO4 |
|---|---|
| Molecular weight | 193.16 g/mol |
| IUPAC name | 8-nitro-2,3-dihydrochromen-4-one |
| InChIKey | MXMKEUBEHSMVOG-UHFFFAOYSA-N |
| SMILES | C1COC2=C(C1=O)C=CC=C2[N+](=O)[O-] |
Computed by PubChem (NCBI)