CAS 903557-35-7 is the registry number for (S)-1-Amino-2,3-dihydro-1H-indene-5-carboxylic acid hydrochloride, 98%. Offered by: AmBeed. Available pack sizes: 1g.
(1S)-1-amino-2,3-dihydro-1H-indene-5-carboxylic acid;hydrochloride (CAS 903557-35-7) is a chemical compound with the molecular formula C10H12ClNO2 and a molecular weight of 213.66 g/mol. IUPAC name: (1S)-1-amino-2,3-dihydro-1H-indene-5-carboxylic acid;hydrochloride. InChIKey: OFAMSVBMELYMRO-FVGYRXGTSA-N.
| Molecular formula | C10H12ClNO2 |
|---|---|
| Molecular weight | 213.66 g/mol |
| IUPAC name | (1S)-1-amino-2,3-dihydro-1H-indene-5-carboxylic acid;hydrochloride |
| InChIKey | OFAMSVBMELYMRO-FVGYRXGTSA-N |
| SMILES | C1CC2=C([C@H]1N)C=CC(=C2)C(=O)O.Cl |
Computed by PubChem (NCBI)