Products 90417-29-1
CAS 90417-29-1 appears in our catalog under these names: 6–Amino–1H–indole–3–carboxylic acid, 6-amino-1H-indole-3-carboxylic acid, 6-Amino-1H-indole-3-carboxylic acid 97%, 6-Amino-1H-indole-3-carboxylic acid, 97%, 97%, 6-AMINO-1H-INDOLE-3-CARBOXYLIC ACID, 95%. Offered by: GLPBio, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 10g, 1g, 250mg, 5g, 500mg, 2.5g.
6-amino-1H-indole-3-carboxylic acid (CAS 90417-29-1) is a chemical compound with the molecular formula C9H8N2O2 and a molecular weight of 176.17 g/mol. IUPAC name: 6-amino-1H-indole-3-carboxylic acid. InChIKey: LOPPIPLZGUYXJD-UHFFFAOYSA-N.
| Molecular formula | C9H8N2O2 |
|---|---|
| Molecular weight | 176.17 g/mol |
| IUPAC name | 6-amino-1H-indole-3-carboxylic acid |
| InChIKey | LOPPIPLZGUYXJD-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1N)NC=C2C(=O)O |
Computed by PubChem (NCBI)