Products 904667-47-6
CAS 904667-47-6 appears in our catalog under these names: 2-Cyano-2-(2,3-dihydro-3-oxo-1H-isoindol-1-ylidene)-N-methylacetamide, >95% (HPLC), 2-Cyano-2-(2,3-dihydro-3-oxo-1H-isoindol-1-ylidene)-N-methylacetamide. Offered by: TRC, Biosynth. Available pack sizes: 100mg, 10mg, 50mg, 25mg.
(2Z)-2-cyano-N-methyl-2-(3-oxoisoindol-1-ylidene)acetamide (CAS 904667-47-6) is a chemical compound with the molecular formula C12H9N3O2 and a molecular weight of 227.22 g/mol. IUPAC name: (2Z)-2-cyano-N-methyl-2-(3-oxoisoindol-1-ylidene)acetamide. InChIKey: DBCRNBKBCOOQJC-KTKRTIGZSA-N.
| Molecular formula | C12H9N3O2 |
|---|---|
| Molecular weight | 227.22 g/mol |
| IUPAC name | (2Z)-2-cyano-N-methyl-2-(3-oxoisoindol-1-ylidene)acetamide |
| InChIKey | DBCRNBKBCOOQJC-KTKRTIGZSA-N |
| SMILES | CNC(=O)/C(=C\1/C2=CC=CC=C2C(=O)N1)/C#N |
Computed by PubChem (NCBI)