CAS 90484-53-0 appears in our catalog under these names: Methyl 3–bromo–4–formylbenzoate, Methyl 3-bromo-4-formylbenzoate 98%, Methyl 3-Bromo-4-formylbenzoate, 97%, 97%, Methyl 3-bromo-4-formylbenzoate, 97%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 5g, 100mg, 25g, 10g, 50g, 100g.
Methyl 3-bromo-4-formylbenzoate (CAS 90484-53-0) is a chemical compound with the molecular formula C9H7BrO3 and a molecular weight of 243.05 g/mol. IUPAC name: methyl 3-bromo-4-formylbenzoate. InChIKey: OILDTPUIIUEPFL-UHFFFAOYSA-N.
| Molecular formula | C9H7BrO3 |
|---|---|
| Molecular weight | 243.05 g/mol |
| IUPAC name | methyl 3-bromo-4-formylbenzoate |
| InChIKey | OILDTPUIIUEPFL-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=C(C=C1)C=O)Br |
Computed by PubChem (NCBI)