CAS 904923-60-0 is the registry number for 4-Chloro-n-methoxy-n,3-dimethylbenzamide, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 25g, 10g, 1g, 250mg.
4-chloro-N-methoxy-N,3-dimethylbenzamide (CAS 904923-60-0) is a chemical compound with the molecular formula C10H12ClNO2 and a molecular weight of 213.66 g/mol. IUPAC name: 4-chloro-N-methoxy-N,3-dimethylbenzamide. InChIKey: BMAQQBYNHFYZEE-UHFFFAOYSA-N.
| Molecular formula | C10H12ClNO2 |
|---|---|
| Molecular weight | 213.66 g/mol |
| IUPAC name | 4-chloro-N-methoxy-N,3-dimethylbenzamide |
| InChIKey | BMAQQBYNHFYZEE-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)C(=O)N(C)OC)Cl |
Computed by PubChem (NCBI)