Products 90610-31-4

CAS 90610-31-4 is the registry number for 2-Propoxyisonicotinic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2-propoxypyridine-4-carboxylic acid (CAS 90610-31-4) is a chemical compound with the molecular formula C9H11NO3 and a molecular weight of 181.19 g/mol. IUPAC name: 2-propoxypyridine-4-carboxylic acid. InChIKey: FGHRAANIUNNEQF-UHFFFAOYSA-N.

Identity
Molecular formulaC9H11NO3
Molecular weight181.19 g/mol
IUPAC name2-propoxypyridine-4-carboxylic acid
InChIKeyFGHRAANIUNNEQF-UHFFFAOYSA-N
SMILESCCCOC1=NC=CC(=C1)C(=O)O

Computed by PubChem (NCBI)