CAS 90767-17-2 appears in our catalog under these names: 3-Bromonaphthalen-1-ol 95%, 3-Bromo-1-hydroxynaphthalene, 97%, 97%, 3-Bromonaphthalen-1-ol, 95%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g.
3-bromonaphthalen-1-ol (CAS 90767-17-2) is a chemical compound with the molecular formula C10H7BrO and a molecular weight of 223.07 g/mol. IUPAC name: 3-bromonaphthalen-1-ol. InChIKey: QSAZQMOSZQCHHU-UHFFFAOYSA-N.
| Molecular formula | C10H7BrO |
|---|---|
| Molecular weight | 223.07 g/mol |
| IUPAC name | 3-bromonaphthalen-1-ol |
| InChIKey | QSAZQMOSZQCHHU-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=C(C=C2O)Br |
Computed by PubChem (NCBI)