Products 908600-70-4
CAS 908600-70-4 appears in our catalog under these names: 5-Fluoroindole-4-carboxylic acid, 95-<97%, 5-Fluoroindole-4-carboxylic acid, ≥97-<99%, 5–Fluoro–1H–indole–4–carboxylic acid, 5-Fluoro-1H-indole-4-carboxylic acid, 5-Fluoro-1H-indole-4-carboxylic acid, 97%. Offered by: Hoffman Fine Chemicals, GLPBio, Biosynth, AmBeed, Chemat. Available pack sizes: 1g, 2,5g, 5g, 10g, 25g, 100mg, 250mg.
5-fluoro-1H-indole-4-carboxylic acid (CAS 908600-70-4) is a chemical compound with the molecular formula C9H6FNO2 and a molecular weight of 179.15 g/mol. IUPAC name: 5-fluoro-1H-indole-4-carboxylic acid. InChIKey: WAEMHSZWSHYBDH-UHFFFAOYSA-N.
| Molecular formula | C9H6FNO2 |
|---|---|
| Molecular weight | 179.15 g/mol |
| IUPAC name | 5-fluoro-1H-indole-4-carboxylic acid |
| InChIKey | WAEMHSZWSHYBDH-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C2=C1NC=C2)C(=O)O)F |
Computed by PubChem (NCBI)